yahir3fl yahir3fl

02-11-2020
English

contestada

Everything else in the written language other than actual numbers or letters is called:
a. Spelling
c. Punctuation
b. Vocabulary
d. Emphasis

Respuesta :

gavin6920 gavin6920

02-11-2020

It’s punctuation c.

Answer Link

Otras preguntas

Which of the following was an important politician who supported moderate progressive reform?

What was the American naval strategy?

cosec(6b+pi/8)=sec(2b-pi/8)

Think It Over 5. Why do you think the Ten Commandments are meaningful to many different religious groups:

Write the equation of the line parallel to y=2 and that has a y-intercept of -1

Greg is 5 feet three inches tall and weighs 260 pounds. According to his _______greg is obese. A. Metabolism B. Obesity index C. Weight set point D. Body mass

Public Domain According to this map, which of the following states had a loss in population between the years 2000 and 2010? Maine Michigan MontanaMissouri

Alexander invested $850 in an account paying an interest rate of 4.7% compounded continuously. Assuming no deposits or withdrawals are made, how much money, to

Charlize was sitting at her desk playing on her phone as if she didn't have anything to do. * O simple O complex O compound-complex O compound

45/50 + 50/50 equals what