amelia0701 amelia0701
  • 03-10-2018
  • Mathematics
contestada

What is 304,800,400 in expanded form?

Respuesta :

samrabesic2006 samrabesic2006
  • 03-10-2018

300,000,000+4,000,000+800,000+400

Answer Link
alexiaprincess4
alexiaprincess4 alexiaprincess4
  • 03-10-2018

300,000,000+4,000,000+800,000+400

Answer Link

Otras preguntas

I dont have a sewing machine so please help. Much appreciated.
If possible, find the area of the triangle defined by the following: a = 1.2, c = 2.1, β = 5°.
Why was the North Atlantic Treaty Organization formed in 1949? A. To protect against an aggressive China in Asia B. To ensure that Germany would
which term describes lines that meet at right angles? a. perpendicular b. parallel c. skew d. adjacent
The house and senate can only pass amendments of the constitution if
What is an example of a chemical reaction
For which scenario would a rousing march be appropriate? Help ASAP, plz right answers A. During a motivational sermon B. Through a sad scene in a movi
Convert -630° from degrees to radians. use the value of π found on a calculator and round answers to four decimal places, as needed.
How did the 14th and 15th amendments change the constitution?
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)