weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

A diamond with a mass of 45 g hangs motionless from a chain. what is the upward force of the chain on the diamond?

Identify the sentence that uses adjectives correctly. a. if i'm not mistaken, that rose is the most reddest of all. b. if i'm not mistaken, that rose is the r

y is a number such that 6y = 12

What is the structure of the following sentence? We looked for seashells on the beach, but we did not find any sand dollars. simple complex compound-c

what is the formula equation for the reaction between sulfuric acid and dissolved sodium hydroxide if all products and reactants are in the aqueous or liquid ph

which component of blood makes up 55 percent of the blood volume?

jane gets bitten by a mosquito. through the bite, she can become infected with an organism carried by the mosquito. what role did the mosquito play in the chain

Microsoft Windows is automatically launched when you turn on your computer

during the early 1800s, what did new england's textile industry and cotton farming in the south have in common?

15x 2x can be written as _____. x(15 2x) (15 2)x (15x 2x)x