raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

What is the median of the following set of numbers? 16, 12, 18, 17, 13, 13, 12, 14, 15, 19 A.12 B.13.2 C.14.5 D.14.9
Which of the following developments is an example of industrialization?
Which of the following is a direct benefit of good flexibility? a. increased muscle strength b. increased range of motion c. improved muscle endurance d. non
Reflecting telescopes are popular because they're A. more durable than a refracting telescope. B. smaller than a refracting telescope. C. more powerful than a
when the moon earth and sun ar aligned in what order what phase of the moon do we see A.new moon B.crescent moon C.quater moon D.full moon
What might a strict person do
outlinr how the social factors can affect an individuals views on death and dying
Plagiarism is often times described as: A. an honest mistake. B. literary theft. C. cheating. D. Both b & c
What is the meaning of parasitology?
When working muscle cells are deprived of oxygen they produce?