GraylenI32932 GraylenI32932
  • 03-11-2022
  • Mathematics
contestada

6. Write a regression equation for the data above. (MD1)Answer of 5. is C.

6 Write a regression equation for the data above MD1Answer of 5 is C class=

Respuesta :

AdalenP338392 AdalenP338392
  • 03-11-2022

Looking at the graph of item C in question 5, we can see that it is a straight line, so it is represented by a linear equation of the form:

[tex]y=mx+b[/tex]

We can also see that, when the value of x increases, the value of y also increases, which means the slope of the line is positive (m > 0).

With this information and looking at the options, we can conclude that the correct option is B.

Answer Link

Otras preguntas

what is the u.s. conversion to Swiss Francs
If mCE = 40°, and mCDE = 30°, what is mAB?A. 70°B. 100°C. 140°D. 20°
how do scientists look for black holes in space
When will salt become less soluble in water?
The value of x + x(xx) when x = 2 is: (a) 10, (b) 16, (c) 18, (d) 36, (e) 64
Someone please help me with number 5. I really don't understand this.
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
Is it true that the planes x + 2y − 2z = 7 and x + 2y − 2z = −5 are two units away from the plane x + 2y − 2z = 1?
Is the underlined verb in the sentence a regular verb or an irregular verb? Astronauts flew into space to work on the International Space Station. A.
How is energy associated with food stored? a. potential energy in chemical form b. kinetic energy in chemical form c. potential energy in mechanical form d. kin